For research use only. Not for therapeutic Use.
Adonirubin is a natural pigment found in certain species of bacteria, particularly those of the genus Streptomyces. This red-colored compound is structurally related to the antibiotic adriamycin and shares similar antitumor properties. Adonirubin’s complex chemical structure and biological activities make it an intriguing subject of research in medicinal chemistry and drug discovery. Scientists are exploring its potential therapeutic applications, particularly in oncology, aiming to harness its cytotoxic effects against cancer cells while minimizing adverse effects on healthy tissues. Further studies are underway to unlock its full therapeutic potential.
CAS Number | 4418-72-8 |
Synonyms | 3-Hydroxy-β,β-carotene-4,4/’-dione; Phenicoxanthin; all-trans-Adonirubin |
Molecular Formula | C40H52O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 6-hydroxy-2,4,4-trimethyl-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-2-en-1-one |
InChI | InChI=1S/C40H52O3/c1-28(17-13-19-30(3)21-23-34-32(5)36(41)25-26-39(34,7)8)15-11-12-16-29(2)18-14-20-31(4)22-24-35-33(6)38(43)37(42)27-40(35,9)10/h11-24,37,42H,25-27H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,28-15+,29-16+,30-19+,31-20+ |
InChIKey | OOUTWVMJGMVRQF-ROKXECAJSA-N |
SMILES | CC1=C(C(CCC1=O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(C(=O)C(CC2(C)C)O)C)C)C |