For research use only. Not for therapeutic Use.
AEBSF hydrochloride(Cat No.:I003091) is an irreversible inhibitor commonly used to inhibit serine proteases, including chymotrypsin, kallikrein, plasmin, thrombin, and trypsin. As a serine protease inhibitor, AEBSF hydrochloride forms a covalent bond with the active site serine residue of these enzymes, irreversibly inactivating them. By blocking the activity of serine proteases, AEBSF hydrochloride is utilized in various research applications and laboratory experiments where the specific inhibition of serine proteases is desired, allowing for the investigation of their roles in physiological and pathological processes.
Catalog Number | I003091 |
CAS Number | 30827-99-7 |
Synonyms | 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
Molecular Formula | C₈H₁₀FNO₂S.HCl |
Purity | ≥95% |
Target | Serine Protease |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | 2-8°C |
IUPAC Name | 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
InChI | InChI=1S/C8H10FNO2S.ClH/c9-13(11,12)8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H |
InChIKey | WRDABNWSWOHGMS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
Reference | <p style=/line-height:25px/> |