For research use only. Not for therapeutic Use.
17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic acid(Cat No.:M017717) is utilized in the synthesis of acylating reagents incorporating glutamic acid, which are employed for selective acylation of amino groups in peptides or proteins. This process, known as sexual acylation, involves introducing specific acyl groups to amino residues to modify or functionalize the peptide or protein. The introduction of these acyl groups enables researchers to manipulate the properties and functions of peptides or proteins for various biotechnological and pharmaceutical applications.
CAS Number | 1143516-05-5 |
Synonyms | AEEA-AEEA;AEEA-AEEA-AEEA;17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic acid |
Molecular Formula | C12H24N2O7 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C12H24N2O7/c13-1-3-18-5-7-20-9-11(15)14-2-4-19-6-8-21-10-12(16)17/h1-10,13H2,(H,14,15)(H,16,17) |
InChIKey | YQZVQKYXWPIKIX-UHFFFAOYSA-N |
SMILES | C(COCCOCC(=O)NCCOCCOCC(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |