For research use only. Not for therapeutic Use.
(+)-Aeroplysinin-1 (Cat No.:R066973) is a natural product and a bioactive compound found in marine sponges. It exhibits various pharmacological properties and has been of interest in pharmaceutical research. (+)-Aeroplysinin-1 is known for its potential anti-inflammatory, antioxidant, and anticancer activities. Studies have shown that it can modulate certain signaling pathways related to inflammation and oxidative stress. Additionally, (+)-Aeroplysinin-1 has demonstrated cytotoxic effects against certain cancer cell lines, making it a promising candidate for further exploration as a potential anticancer agent.
CAS Number | 28656-91-9 |
Synonyms | NSC 170364 |
Molecular Formula | C9H9Br2NO3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 2-[(1S,6R)-3,5-dibromo-1,6-dihydroxy-4-methoxycyclohexa-2,4-dien-1-yl]acetonitrile |
InChI | InChI=1S/C9H9Br2NO3/c1-15-7-5(10)4-9(14,2-3-12)8(13)6(7)11/h4,8,13-14H,2H2,1H3/t8-,9-/m0/s1 |
InChIKey | BGYNLOSBKBOJJD-IUCAKERBSA-N |
SMILES | COC1=C([C@@H]([C@@](C=C1Br)(CC#N)O)O)Br |