For research use only. Not for therapeutic Use.
Aflatoxin M1-(O-carboxymethyl)oxime(Cat No.:M116314) is a derivative of aflatoxin M1, a mycotoxin produced by certain fungi that contaminate food and feed. The modification to form the oxime derivative involves the addition of a carboxymethyl group. This derivative is of interest due to its potential use in analytical chemistry and toxicology studies to better understand the metabolism, distribution, and toxicity of aflatoxin M1 in biological systems.
CAS Number | 127862-46-8 |
Synonyms | aflatoxin M1-(O-carboxymethyl)oxime |
Molecular Formula | C19H15NO9 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 2-[(E)-[(3R,7R)-3-hydroxy-11-methoxy-18-oxo-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,4,9,11,13(17)-pentaen-16-ylidene]amino]oxyacetic acid |
InChI | InChI=1S/C19H15NO9/c1-25-10-6-11-15(19(24)4-5-26-18(19)28-11)16-14(10)8-2-3-9(13(8)17(23)29-16)20-27-7-12(21)22/h4-6,18,24H,2-3,7H2,1H3,(H,21,22)/b20-9+/t18-,19-/m1/s1 |
InChIKey | KDQXYCUSOMGQMS-CXHUKFPDSA-N |
SMILES | COC1=C2C3=C(C(=NOCC(=O)O)CC3)C(=O)OC2=C4C(=C1)OC5C4(C=CO5)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |