For research use only. Not for therapeutic Use.
AFM32a hydrochloride（Cat No.:I042845）is a potent small molecule inhibitor designed to target and block the activity of specific kinases involved in cellular signaling pathways, particularly those associated with tumor growth and progression. It is being investigated for its potential in cancer therapy, where dysregulated kinase activity plays a significant role in malignancy. By inhibiting these pathways, AFM32a hydrochloride may reduce tumor cell proliferation, induce apoptosis, and improve the efficacy of existing cancer treatments. Ongoing research is exploring its role in treating various solid tumors, offering a promising addition to cancer therapeutics.
| CAS Number | 2988594-85-8 |
| Synonyms | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(4-ethoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide;hydrochloride |
| Molecular Formula | C25H30ClFN6O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(4-ethoxy-1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide;hydrochloride |
| InChI | InChI=1S/C25H29FN6O3.ClH/c1-3-35-19-11-5-10-18-22(19)31-23(32(18)2)17(9-6-12-28-20(27)13-26)30-24(33)16-8-4-7-15-14-29-25(34)21(15)16;/h4-5,7-8,10-11,17H,3,6,9,12-14H2,1-2H3,(H2,27,28)(H,29,34)(H,30,33);1H/t17-;/m0./s1 |
| InChIKey | PSVXWWOSYOYZKQ-LMOVPXPDSA-N |
| SMILES | CCOC1=CC=CC2=C1N=C(N2C)[C@H](CCCN=C(CF)N)NC(=O)C3=CC=CC4=C3C(=O)NC4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
