For research use only. Not for therapeutic Use.
AG-1478 (Cat No.:I001925) is a highly selective inhibitor of the epidermal growth factor receptor (EGFR). With an IC50 value of 3 nM, it effectively inhibits EGFR activity. Notably, AG-1478 displays minimal activity against other receptor tyrosine kinases such as HER2-Neu, PDGFR, Trk, Bcr-Abl, and InsR. This selectivity makes AG-1478 a valuable tool in studying EGFR signaling pathways and exploring its potential as a therapeutic agent for EGFR-dependent cancers while minimizing off-target effects on other receptor systems.
| Catalog Number | I001925 |
| CAS Number | 153436-53-4 |
| Synonyms | N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine |
| Molecular Formula | C16H14ClN3O2 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO 25 mg/mL; Water <1 mg/mL; Ethanol 13 mg/mL |
| Storage | 2-8°C |
| IC50 | 3 nM |
| IUPAC Name | N-(3-chlorophenyl)-6,7-dimethoxyquinazolin-4-amine |
| InChI | InChI=1S/C16H14ClN3O2/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11/h3-9H,1-2H3,(H,18,19,20) |
| InChIKey | GFNNBHLJANVSQV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=CC=C3)Cl)OC |
