For research use only. Not for therapeutic Use.
Agaridoxin is a mushroom metabolite.
| Catalog Number | I021513 |
| CAS Number | 58298-77-4 |
| Synonyms | Agaridoxin; |
| Molecular Formula | C11H14N2O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (3,4-dihydroxyphenyl)-L-glutamine |
| InChI | InChI=1S/C11H14N2O5/c12-10(16)4-2-7(11(17)18)13-6-1-3-8(14)9(15)5-6/h1,3,5,7,13-15H,2,4H2,(H2,12,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | SGMDQKBASJSDDV-ZETCQYMHSA-N |
| SMILES | Oc1ccc(N[C@@H](CCC(N)=O)C(O)=O)cc1O |
| Reference | 1: Szent-Gyorgyi A, Chung RH, Boyajian MJ, Tishler M, Arison BH, Schoenewaldt EF, Wittick JJ. Agaridoxin, a mushroom metabolite. Isolation, structure, and synthesis. J Org Chem. 1976 Apr 30;41(9):1603-6. PubMed PMID: 944247. |
