For research use only. Not for therapeutic Use.
AGN 195183（Cat No.:I003352）is a potent and selective inhibitor of RARγ (retinoic acid receptor gamma), which plays a significant role in regulating cellular growth, differentiation, and apoptosis. By selectively targeting RARγ, AGN 195183 modulates gene expression related to cell proliferation, making it valuable in research on skin diseases, cancers, and immune disorders where RARγ pathways are implicated. Its specificity minimizes off-target effects on other retinoic acid receptors, allowing for focused therapeutic potential. AGN 195183 is instrumental in studies on retinoid signaling and developing targeted therapies for RARγ-associated conditions.
| Catalog Number | I003352 |
| CAS Number | 367273-07-2 |
| Synonyms | (Z)-4-(((4-chloro-3-hydroxy-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)(hydroxy)methylene)amino)-2,6-difluorobenzoic acid |
| Molecular Formula | C22H22ClF2NO4 |
| Purity | ≥95% |
| Target | RAR/RXR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 3 nM (Kd); 200 nM (EC80, RAR Trans.) |
| IUPAC Name | 4-[(4-chloro-3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]-2,6-difluorobenzoic acid |
| InChI | InChI=1S/C22H22ClF2NO4/c1-21(2)5-6-22(3,4)16-12(21)9-11(18(27)17(16)23)19(28)26-10-7-13(24)15(20(29)30)14(25)8-10/h7-9,27H,5-6H2,1-4H3,(H,26,28)(H,29,30) |
| InChIKey | PNAWUIKCVQSLFG-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C(C(=C2Cl)O)C(=O)NC3=CC(=C(C(=C3)F)C(=O)O)F)(C)C)C |
| Reference | <p style=/line-height:25px/> |
