For research use only. Not for therapeutic Use.
Agomelatine-d6 (CAS 1079389-42-6) is a high-purity deuterated compound used in advanced pharmaceutical research. This isotopically labeled version of Agomelatine is essential for studies involving antidepressants, pharmacokinetics, and metabolic pathways. Featuring six deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for neuropharmacology and drug development, Agomelatine-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | S000070 |
| CAS Number | 1079389-42-6 |
| Molecular Formula | C15H11D6NO2 |
| Purity | ≥95% |
| IUPAC Name | 2,2,2-trideuterio-N-[2-[7-(trideuteriomethoxy)naphthalen-1-yl]ethyl]acetamide |
| InChI | InChI=1S/C15H17NO2/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13/h3-7,10H,8-9H2,1-2H3,(H,16,17)/i1D3,2D3 |
| InChIKey | YJYPHIXNFHFHND-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC([2H])([2H])[2H] |
