For research use only. Not for therapeutic Use.
Agomelatine is an antidepressant medication that acts as a melatonergic agonist and serotonin receptor antagonist. It helps regulate circadian rhythms and improve sleep patterns, which can be disrupted in depression. Tartaric acid is commonly used as an excipient in pharmaceutical formulations, often to stabilize or enhance the absorption of active ingredients. When combined, agomelatine and tartaric acid may form a stable compound that ensures optimal delivery and efficacy of the drug. Agomelatine is primarily prescribed for major depressive disorder and has a unique action compared to traditional antidepressants, focusing on sleep-wake cycle regulation.
CAS Number | 824393-18-2 |
Molecular Formula | C₁₉H₂₃NO₈ |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
InChI | InChI=1S/C15H17NO2.C4H6O6/c1-11(17)16-9-8-13-5-3-4-12-6-7-14(18-2)10-15(12)13;5-1(3(7)8)2(6)4(9)10/h3-7,10H,8-9H2,1-2H3,(H,16,17);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
InChIKey | PJOPJXPTFZIKTL-LREBCSMRSA-N |
SMILES | CC(=O)NCCC1=CC=CC2=C1C=C(C=C2)OC.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |