For research use only. Not for therapeutic Use.
AGPS-IN-1 (CAT: I021554) is a potent inhibitor of alkylglycerone phosphate synthase (AGPS), an enzyme crucial for ether lipid biosynthesis. By binding effectively to AGPS, AGPS-IN-1 reduces ether lipid levels and decreases cell migration rates. Notably, it inhibits epithelial-mesenchymal transition (EMT) in prostate cancer PC-3 and breast cancer MDA-MB-231 cells. This compound has a molecular formula of C₁₈H₁₇F₂N₃O₂ and a molecular weight of 345.34 g/mol. AGPS-IN-1 serves as a valuable tool in cancer research, particularly in studying lipid metabolism’s role in tumor progression and metastasis.
| CAS Number | 2316782-88-2 |
| Synonyms | 3-(2,6-difluorophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]butanamide |
| Molecular Formula | C18H17F2N3O2 |
| Purity | ≥95% |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]butanamide |
| InChI | InChI=1S/C18H17F2N3O2/c1-10(17-12(19)3-2-4-13(17)20)7-16(24)21-9-11-5-6-14-15(8-11)23-18(25)22-14/h2-6,8,10H,7,9H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | VDLFVZUKOKPJRH-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)NCC1=CC2=C(C=C1)NC(=O)N2)C3=C(C=CC=C3F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
