For research use only. Not for therapeutic Use.
AHR antagonist 2 is a potent aryl hydrocarbon receptor (AHR) antagonist, extracted from patent WO2019101641A1, compound example 1, with IC50s of 0.885 and 2.03 nM for human and mouse AhR[1].
| Catalog Number | I016820 |
| CAS Number | 2338747-54-7 |
| Synonyms | N-[(2S)-1-hydroxypropan-2-yl]-2-pyridin-3-yl-6-[4-(trifluoromethoxy)phenyl]pyrimidine-4-carboxamide |
| Molecular Formula | C20H17F3N4O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H17F3N4O3/c1-12(11-28)25-19(29)17-9-16(26-18(27-17)14-3-2-8-24-10-14)13-4-6-15(7-5-13)30-20(21,22)23/h2-10,12,28H,11H2,1H3,(H,25,29)/t12-/m0/s1 |
| InChIKey | CSSGBPKFVJOAIZ-LBPRGKRZSA-N |
| SMILES | CC(CO)NC(=O)C1=NC(=NC(=C1)C2=CC=C(C=C2)OC(F)(F)F)C3=CN=CC=C3 |
| Reference | [1]. Julien LEFRANC, et al. 2-hetarylpyrimidine-4-carboxamides as aryl hydrocarbon receptor anatgonists. WO2019101641A1. |
