For research use only. Not for therapeutic Use.
AI3-20213 (Cat.No:I014035) is a chemical compound used as a synthetic intermediate in organic synthesis. It plays a crucial role in building more complex molecules due to its versatile reactivity and functional groups. AI3-20213’s strategic incorporation aids in the creation of diverse compounds with potential applications in pharmaceuticals and materials science.
| Catalog Number | I014035 |
| CAS Number | 2345-34-8 |
| Synonyms | AI3-20213; AI3 20213; AI320213; NSC 11340; NSC-11340; NSC11340;Benzoic acid, 4-(acetyloxy)- |
| Molecular Formula | C9H8O4 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | GDBUZIKSJGRBJP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=CC=C(OC(C)=O)C=C1 |
