For research use only. Not for therapeutic Use.
AICAR phosphate (Cat No.:I004559)(5-aminoimidazole-4-carboxamide ribonucleotide phosphate) is a purine nucleotide that acts as an AMP-activated protein kinase (AMPK) activator, playing a critical role in cellular energy regulation. By enhancing AMPK activity, AICAR phosphate promotes glucose uptake, fatty acid oxidation, and metabolic adaptations, making it a valuable compound in research on metabolic disorders, diabetes, and exercise physiology. Its potential effects on improving endurance and muscle metabolism have garnered interest in the fields of sports science and pharmacology. AICAR phosphate serves as a key tool for studying energy homeostasis and metabolic regulation.
CAS Number | 681006-28-0 |
Synonyms | 5-amino-1-(3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-imidazole-4-carboxamide phosphate |
Molecular Formula | C9H17N4O9P |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Solubility | 10 mM in H2O |
IUPAC Name | 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide;phosphoric acid |
InChI | InChI=1S/C9H14N4O5.H3O4P/c10-7-4(8(11)17)12-2-13(7)9-6(16)5(15)3(1-14)18-9;1-5(2,3)4/h2-3,5-6,9,14-16H,1,10H2,(H2,11,17);(H3,1,2,3,4)/t3-,5-,6-,9-;/m1./s1 |
InChIKey | BPVGMEHURDEDAZ-GWTDSMLYSA-N |
SMILES | C1=NC(=C(N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)C(=O)N.OP(=O)(O)O |
Reference | <p style=/line-height:25px/> |