For research use only. Not for therapeutic Use.
AKB48 N-Pentanoic Acid(CAT: R018489) is a synthetic cannabinoid compound that is structurally related to the more commonly known AKB48 (also known as APINACA). This particular analog features a pentanoic acid group, which can influence its pharmacological properties. Synthetic cannabinoids like AKB48 N-Pentanoic Acid are designed to mimic the effects of naturally occurring cannabinoids, such as THC, by interacting with the cannabinoid receptors in the brain. These compounds are often studied for their potential therapeutic applications, including pain relief, anti-inflammatory effects, and neurological research. However, due to their potency and potential for adverse effects, synthetic cannabinoids are also subject to regulatory scrutiny and are often monitored for their potential abuse. AKB48 N-Pentanoic Acid, like other synthetic cannabinoids, is of interest in both medical research and forensic science for understanding its effects, metabolism, and potential risks.
Catalog Number | R018489 |
CAS Number | 1630022-94-4 |
Synonyms | APINACA N-Pentanoic Acid; 5-(3-((3s,5s,7s)-Adamantan-1-ylcarbamoyl)-1H-indazol-1-yl)pentanoic Acid |
Molecular Formula | C23H29N3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-[3-(1-adamantylcarbamoyl)indazol-1-yl]pentanoic acid |
InChI | InChI=1S/C23H29N3O3/c27-20(28)7-3-4-8-26-19-6-2-1-5-18(19)21(25-26)22(29)24-23-12-15-9-16(13-23)11-17(10-15)14-23/h1-2,5-6,15-17H,3-4,7-14H2,(H,24,29)(H,27,28) |
InChIKey | CMCIJYXHEYJYQU-UHFFFAOYSA-N |
SMILES | C1C2CC3CC1CC(C2)(C3)NC(=O)C4=NN(C5=CC=CC=C54)CCCCC(=O)O |