For research use only, not for therapeutic use.
AKI603（Cat No.:I021676）is a selective inhibitor of the protein kinase PAK4, which is implicated in cancer cell proliferation and survival. By targeting PAK4, AKI603 disrupts critical signaling pathways associated with tumor growth and metastasis, making it a promising candidate for cancer therapy. Preclinical studies have demonstrated its ability to induce apoptosis in cancer cell lines and inhibit tumor growth in various models. Additionally, ongoing research is focused on its potential in combination therapies, enhancing the efficacy of existing treatments. AKI603 represents a valuable tool for investigating PAK4’s role in oncogenesis and therapeutic resistance.
| Catalog Number | I021676 |
| CAS Number | 1432515-73-5 |
| Synonyms | AKI-603; AKI 603; AKI603 |
| Molecular Formula | C19H23N9O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-4-N-(5-methyl-1H-pyrazol-3-yl)-2-N-(4-nitrophenyl)pyrimidine-2,4-diamine |
| InChI | InChI=1S/C19H23N9O2/c1-13-11-17(25-24-13)21-16-12-18(27-9-7-26(2)8-10-27)23-19(22-16)20-14-3-5-15(6-4-14)28(29)30/h3-6,11-12H,7-10H2,1-2H3,(H3,20,21,22,23,24,25) |
| InChIKey | UNKOUVAYOLLXER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=CC(=NC(=N2)NC3=CC=C(C=C3)[N+](=O)[O-])N4CCN(CC4)C |
