For research use only. Not for therapeutic Use.
Akt Inhibitor (10-NCP)(Cat No.:I010580)is a selective small-molecule inhibitor of Akt, a key kinase involved in the PI3K/Akt/mTOR signaling pathway, which regulates cell survival, growth, and proliferation. By inhibiting Akt activity, 10-NCP disrupts critical processes in cancer cells, leading to reduced cell survival and increased apoptosis. This makes it a valuable compound in oncology research, particularly for studying cancers driven by hyperactive Akt signaling. Its specificity for Akt also enables its use in exploring targeted cancer therapies and understanding Akt’s role in various cellular processes, including metabolism and inflammation.
Catalog Number | I010580 |
CAS Number | 925681-41-0 |
Synonyms | 10-[4/’-(N,N-Diethylamino)butyl]-2-chlorophenoxazine hydrochloride |
Molecular Formula | C20H26Cl2N2O |
Purity | ≥95% |
Target | Anti-infection |
Solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
Storage | Store at 4℃ |
IUPAC Name | 4-(2-chlorophenoxazin-10-yl)-N,N-diethylbutan-1-amine;hydrochloride |
InChI | InChI=1S/C20H25ClN2O.ClH/c1-3-22(4-2)13-7-8-14-23-17-9-5-6-10-19(17)24-20-12-11-16(21)15-18(20)23;/h5-6,9-12,15H,3-4,7-8,13-14H2,1-2H3;1H |
InChIKey | SVKSJUIYYCQZEC-UHFFFAOYSA-N |
SMILES | CCN(CC)CCCCN1C2=CC=CC=C2OC3=C1C=C(C=C3)Cl.Cl |