For research use only. Not for therapeutic Use.
Isozyme-selective Akt inhibitors(Cat No.:I004314)are compounds designed to target specific isoforms of the Akt kinase, such as Akt1, Akt2, or Akt3, which play distinct roles in various cellular processes, including growth, survival, and metabolism. By selectively inhibiting a particular Akt isozyme, these inhibitors allow for precise modulation of signaling pathways, minimizing off-target effects and reducing toxicity. Isozyme-selective Akt inhibitors are valuable in cancer research, as different Akt isoforms contribute to tumorigenesis in various cancers. Their specificity enhances therapeutic potential in targeted cancer therapies and other Akt-related diseases.
CAS Number | 612847-09-3 |
Synonyms | 3-[1-[[4-(7-phenyl-3H-imidazo[4,5-g]quinoxalin-6-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
Molecular Formula | C₃₄H₂₉N₇O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 58/210/2120 nM(Akt1/2/3) |
IUPAC Name | 3-[1-[[4-(6-phenyl-8H-imidazo[4,5-g]quinoxalin-7-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
InChI | InChI=1S/C34H29N7O/c42-34-39-26-8-4-5-9-31(26)41(34)25-14-16-40(17-15-25)20-22-10-12-24(13-11-22)33-32(23-6-2-1-3-7-23)37-29-18-27-28(36-21-35-27)19-30(29)38-33/h1-13,18-19,21,25,38H,14-17,20H2,(H,39,42) |
InChIKey | IWCQHVUQEFDRIW-UHFFFAOYSA-N |
SMILES | C1CN(CCC1N2C3=CC=CC=C3NC2=O)CC4=CC=C(C=C4)C5=C(N=C6C=C7C(=NC=N7)C=C6N5)C8=CC=CC=C8 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |