For research use only. Not for therapeutic Use.
Akt1-IN-1（Cat No.:I043616）is a selective inhibitor of Akt1, a serine/threonine kinase that plays a crucial role in cell survival, growth, metabolism, and proliferation. By inhibiting Akt1, Akt1-IN-1 disrupts key signaling pathways involved in cancer cell survival, making it a promising candidate for cancer therapy. Akt1 is often overactivated in various cancers, leading to uncontrolled cell growth and resistance to apoptosis. Akt1-IN-1 is being studied for its potential to block these effects, and research is focused on evaluating its efficacy and safety as a therapeutic agent for cancer and other diseases associated with Akt1 activation.
| CAS Number | 374635-48-0 |
| Synonyms | N-[4-(4-fluorocyclohexa-1,3-dien-1-yl)-5-[[1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-2-yl]methoxymethyl]-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide |
| Molecular Formula | C31H32FN5O5S2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-(4-fluorocyclohexa-1,3-dien-1-yl)-5-[[1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridin-2-yl]methoxymethyl]-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide |
| InChI | InChI=1S/C31H34FN5O5S2/c1-20(2)29-27(30(22-8-10-24(32)11-9-22)35-31(34-29)36(4)43(5,38)39)19-42-18-25-16-23-17-33-15-14-28(23)37(25)44(40,41)26-12-6-21(3)7-13-26/h6-8,10,12-17,20H,9,11,18-19H2,1-5H3 |
| InChIKey | ZEMLAHMFSXBYLG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=C(C=C2COCC4=C(N=C(N=C4C(C)C)N(C)S(=O)(=O)C)C5=CC=C(CC5)F)C=NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
