For research use only. Not for therapeutic Use.
Alachlor-d13, a deuterated form of alachlor, is employed as a stable isotopic tracer in environmental and agricultural research. This compound, with its deuterium labels, is instrumental in studying the fate, transport, and degradation of alachlor in various environmental matrices such as soil and water. It helps in tracing and quantifying alachlor’s movement and transformation in ecosystems. Additionally, it is useful in the development and optimization of analytical methods for pesticide residue analysis, providing insights into environmental contamination and regulatory compliance.
Catalog Number | R006677 |
CAS Number | 1015856-63-9 |
Synonyms | 2-Chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide-d13; 2-Chloro-2’,6’-?diethyl-N-(methoxymethyl)acetanilide-d13; 2-Chloro-2’,6’-diethyl-N-methoxy-?methylacetanilide-d13; 2’,6’-Diethyl-N-(methoxymethyl)-2-chloroacetanilide-d13; Alanex-d13; Ala |
Molecular Formula | C14H20ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-N-(methoxymethyl)-N-[3,4,5-trideuterio-2,6-bis(1,1,2,2,2-pentadeuterioethyl)phenyl]acetamide |
InChI | InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3/i1D3,2D3,4D2,5D2,6D,7D,8D |
InChIKey | XCSGPAVHZFQHGE-PTKGBVOGSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])C([2H])([2H])[2H])N(COC)C(=O)CCl)C([2H])([2H])C([2H])([2H])[2H])[2H] |