For research use only. Not for therapeutic Use.
Alahopcin is a new dipeptide antibiotic produced by Streptomyces albulus subsp. ochragerus subsp. nov.
| Catalog Number | I021707 |
| CAS Number | 82576-50-9 |
| Synonyms | Alahopcin; B-52653; Antibiotic B 52653; Antibiotic T 804A; Nourseimycin; |
| Molecular Formula | C9H15N3O6 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-amino-2-((3R,5R)-1,5-dihydroxy-2-oxopyrrolidin-3-yl)acetic (S)-2-aminopropanoic anhydride |
| InChI | InChI=1S/C9H15N3O6/c1-3(10)8(15)18-9(16)6(11)4-2-5(13)12(17)7(4)14/h3-6,13,17H,2,10-11H2,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | NTBVVEFUJUCXPF-KCDKBNATSA-N |
| SMILES | N[C@@H]([C@@H]1C(N(O)[C@H](O)C1)=O)C(OC([C@H](C)N)=O)=O |
