For research use only. Not for therapeutic Use.
The ALANE-DIMETHYLETHYLAMINE COMPLEX(Cat No.:M024450) is a notable chemical compound formed by combining aluminum hydride (ALANE) with dimethylethylamine. This complex exhibits unique reactivity and catalytic properties, making it valuable in various synthetic processes within the field of organic chemistry. Its specific applications include reduction reactions and hydrogen storage systems due to its ability to release and accept hydrogen gas.
CAS Number | 124330-23-0 |
Molecular Formula | C4H11AlN |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | aluminum;N,N-dimethylethanamine |
InChI | InChI=1S/C4H11N.Al/c1-4-5(2)3;/h4H2,1-3H3; |
InChIKey | JFULSLYTSZPADJ-UHFFFAOYSA-N |
SMILES | CCN(C)C.[Al] |