For research use only. Not for therapeutic Use.
Alanine aminotransferase (Cat No.:I041034) from porcine heart is an enzyme involved in amino acid metabolism, specifically catalyzing the reversible transfer of an amino group from alanine to alpha-ketoglutarate, forming pyruvate and glutamate. It plays a critical role in maintaining the balance of amino acids in tissues, including the heart. The porcine heart variant is often studied for its similarities to human ALT, making it useful in research for human metabolic and cardiovascular diseases. ALT activity in the heart reflects cellular health and may be used as a biomarker for heart conditions.
| CAS Number | 9000-86-6 |
| Molecular Formula | C11H16N2O6 |
| Purity | ≥95% |
| IUPAC Name | 1-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C11H16N2O6/c1-5-3-13(11(18)12-10(5)17)8-2-6(15)9(16)7(4-14)19-8/h3,6-9,14-16H,2,4H2,1H3,(H,12,17,18) |
| InChIKey | VVJYUAYZJAKGRQ-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(C(O2)CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
