For research use only. Not for therapeutic Use.
Alantolactone (CAT: I004009) is a natural sesquiterpene lactone found in various medicinal plants. It exhibits diverse pharmacological activities, including anti-inflammatory, anticancer, antimicrobial, and antioxidant properties. Alantolactone has been investigated for its potential as an anticancer agent, as it induces apoptosis and inhibits the growth of cancer cells. It also possesses anti-inflammatory properties by suppressing pro-inflammatory cytokines. Additionally, alantolactone shows antimicrobial activity against various bacteria and fungi. Although further research is needed, alantolactone holds promise as a therapeutic compound for cancer treatment, inflammation-related conditions, and infectious diseases.
CAS Number | 546-43-0 |
Molecular Formula | C15H20O2 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | 100 mM in DMSO; 100 mM in ethanol; |
Storage | store at -20℃ |
IUPAC Name | (3aR,5S,8aR,9aR)-5,8a-dimethyl-3-methylidene-5,6,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-2-one |
InChI | 1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h7,9,11,13H,2,4-6,8H2,1,3H3/t9-,11+,13+,15+/m0/s1 |
InChIKey | PXOYOCNNSUAQNS-AGNJHWRGSA-N |
SMILES | C[C@H]1CCC[C@]2(C1=C[C@H]3[C@@H](C2)OC(=O)C3=C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |