For research use only. Not for therapeutic Use.
Alanylphenylalanine(CAT: I014037) is a dipeptide composed of the amino acids alanine and phenylalanine. It is widely used in biochemical and enzymology research as a model substrate for studying protease activity, particularly for enzymes involved in peptide bond hydrolysis. Its structure and properties make it valuable for exploring protein digestion, peptide transport mechanisms, and enzymatic kinetics. Additionally, Alanylphenylalanine serves as a building block in peptide synthesis and is utilized in investigations into nutrient absorption and metabolism. Its simplicity and versatility make it a useful tool for advancing research in protein biochemistry and related fields.
| Catalog Number | I014037 |
| CAS Number | 3061-90-3 |
| Synonyms | Alanylphenylalanine; Ala-phe; NSC 89630; NSC-89630; NSC89630;;L-alanyl-L-phenylalanine |
| Molecular Formula | C12H16N2O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Solubility | Soluble in DMSO |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-phenylpropanoic acid |
| InChI | InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | OMNVYXHOSHNURL-WPRPVWTQSA-N |
| SMILES | O=C(O)[C@H](CC1=CC=CC=C1)NC([C@H](C)N)=O |
