For research use only. Not for therapeutic Use.
Alarmine-d6 is a deuterated form of alarmine, an organic compound often used in research related to chemical signaling and reaction mechanisms. The six deuterium atoms enhance the stability and accuracy of analytical studies using techniques like NMR and mass spectrometry. Alarmine is involved in investigations of its role in chemical reactions or biological processes. The deuterium labeling allows for precise tracking of the compound’s behavior, metabolism, and interactions, making it valuable for studying reaction mechanisms, optimizing formulations, and understanding the compound’s role in various chemical and biological systems.
CAS Number | 1346604-25-8 |
Synonyms | N1,N4-(Dimethyl-d6)-1,4-benzenediamine; Antioxidant 3100-d6; N,N’-(Dimethyl-d6)-1,4-phenylenediamine; N,N’-(Dimethyl-d6)-p-phenylenediamine; N,N’-(Dimethyl-d6)benzene-1,4-diamine; |
Molecular Formula | C8H12N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine |
InChI | InChI=1S/C8H12N2/c1-9-7-3-5-8(10-2)6-4-7/h3-6,9-10H,1-2H3/i1D3,2D3 |
InChIKey | PVRZMTHMPKVOBP-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])NC1=CC=C(C=C1)NC([2H])([2H])[2H] |