For research use only. Not for therapeutic Use.
ALB-185357 is a biochemical.
| Catalog Number | I021721 |
| CAS Number | 1841125-91-4 |
| Synonyms | ALB-185357; ALB 185357; ALB185357; Metavert |
| Molecular Formula | C16H14N4O4 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-Hydroxy-4-(5-((4-methoxyphenyl)amino)-1,3,4-oxadiazol-2-yl)benzamide |
| InChI | InChI=1S/C16H14N4O4/c1-23-13-8-6-12(7-9-13)17-16-19-18-15(24-16)11-4-2-10(3-5-11)14(21)20-22/h2-9,22H,1H3,(H,17,19)(H,20,21) |
| InChIKey | TWABKXHHSQCZPI-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2oc(nn2)c3ccc(cc3)C(=O)NO)cc1 |
