For research use only. Not for therapeutic Use.
Albendazole-d3(Cat No.:S000422) is a deuterated version of albendazole, where three hydrogen atoms are replaced with deuterium. This modification enhances the drug’s metabolic stability, making it valuable for pharmacokinetic and metabolic research. Albendazole is a broad-spectrum anthelmintic medication used to treat various parasitic worm infestations, such as tapeworms and roundworms. It works by inhibiting the microtubule synthesis in parasitic worms, leading to their immobilization and death. The deuterated version, Albendazole-d3, helps researchers to study the drug’s behavior, metabolism, and excretion in the body more accurately, enhancing understanding of its therapeutic profile.
CAS Number | 1353867-92-1 |
Molecular Formula | C12H12D3N3O2S |
Purity | ≥95% |
Target | Parasite |
IUPAC Name | trideuteriomethyl N-(6-propylsulfanyl-1H-benzimidazol-2-yl)carbamate |
InChI | InChI=1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)/i2D3 |
InChIKey | HXHWSAZORRCQMX-BMSJAHLVSA-N |
SMILES | CCCSC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |