For research use only. Not for therapeutic Use.
Albendazole-d7 is a deuterium-labeled form of albendazole, an antiparasitic drug used to treat a variety of parasitic infections, including those caused by worms and other helminths. The deuterium labeling enhances its application in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, allowing for precise tracking and quantification of the drug and its metabolites. This labeled compound is essential for pharmacokinetic studies, helping researchers understand the drug’s absorption, metabolism, distribution, and excretion. It also aids in optimizing formulations, studying drug interactions, and ensuring the efficacy and safety of albendazole in therapeutic applications.
CAS Number | 1287076-43-0 |
Synonyms | N-[6-(Propylthio-d7)-1H-benzimidazol-2-yl]carbamic Acid Methyl Ester;?[5-(Propylthio-d7)-1H-benzimidazol-2-yl]carbamic Acid Methyl Ester; Albenza-d7; Andazol-d7; Ashialben-d7; Atasol-d7; Bruzol-d7; Eskazole-d7; Loveral-d7; Lurdex-d7; Proftril-d7; Val |
Molecular Formula | C12H15N3O2S |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate |
InChI | InChI=1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)/i1D3,3D2,6D2 |
InChIKey | HXHWSAZORRCQMX-JOMZKNQJSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])SC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |