For research use only. Not for therapeutic Use.
Albendazole oxide(Cat No.:A001155)is a metabolite of albendazole, an anthelmintic medication commonly used to treat parasitic infections, including those caused by worms. As an active compound, albendazole oxide exerts its effects by inhibiting the polymerization of tubulin, disrupting the microtubule formation necessary for cellular division and function in parasites. This leads to the immobilization and death of the parasites. Research suggests that albendazole oxide may also have potential applications in treating certain cancers due to its cytotoxic properties. Its pharmacokinetics and efficacy continue to be explored in various therapeutic contexts.
CAS Number | 54029-12-8 |
Synonyms | Ricobendazole |
Molecular Formula | C12H15N3O3S |
Purity | ≥95% |
Target | Parasite |
Storage | 3 years -20C powder |
IUPAC Name | methyl N-(6-propylsulfinyl-1H-benzimidazol-2-yl)carbamate |
InChI | InChI=1S/C12H15N3O3S/c1-3-6-19(17)8-4-5-9-10(7-8)14-11(13-9)15-12(16)18-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
InChIKey | VXTGHWHFYNYFFV-UHFFFAOYSA-N |
SMILES | CCCS(=O)C1=CC2=C(C=C1)N=C(N2)NC(=O)OC |