For research use only. Not for therapeutic Use.
Albendazole sulfoxide D3 is a deuterated form of albendazole sulfoxide, the active metabolite of the antiparasitic drug albendazole. In this version, three hydrogen atoms are replaced with deuterium, enhancing its utility in pharmacokinetic and metabolic studies. The deuterium labeling allows for precise tracking and differentiation in mass spectrometry and NMR spectroscopy. Despite the isotopic substitution, it retains the antiparasitic properties of the non-deuterated compound, making it valuable for research into drug metabolism, distribution, and efficacy in treating parasitic infections.
Catalog Number | I001732 |
CAS Number | 1448346-38-0 |
Molecular Formula | C12H12D3N3O3S |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | -20℃ |
IUPAC Name | trideuteriomethyl N-(6-propylsulfinyl-1H-benzimidazol-2-yl)carbamate |
InChI | InChI=1S/C12H15N3O3S/c1-3-6-19(17)8-4-5-9-10(7-8)14-11(13-9)15-12(16)18-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)/i2D3 |
InChIKey | VXTGHWHFYNYFFV-BMSJAHLVSA-N |
SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)CCC |