For research use only. Not for therapeutic Use.
ALD-52（Cat No.:I021746）, also referred to as N-acetyl-LSD or D-1-Acetyl lysergic acid diethylamide, is a derivative of d-lysergic acid diethylamide (LSD). It is chemically related to LSD but contains an acetyl group attached to the nitrogen atom. ALD-52 has been described as a prodrug of LSD, meaning it is believed to convert into LSD when ingested. However, it is important to note that ALD-52 is a discontinued substance, and its use is controlled by the Drug Enforcement Administration (DEA) due to its similarities to LSD.
| Catalog Number | I021746 |
| CAS Number | 3270-02-8 |
| Synonyms | D-1-Acetyl lysergic acid diethylamide; ALD-52; N-acetyl-LSD; |
| Molecular Formula | C22H27N3O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | -20°C |
| IUPAC Name | Ergoline-8-carboxamide, 1-acetyl-9,10-didehydro-N,N-diethyl-6-methyl-, (8-beta)- |
| InChI | InChI=1S/C22H27N3O2/c1-5-24(6-2)22(27)16-10-18-17-8-7-9-19-21(17)15(13-25(19)14(3)26)11-20(18)23(4)12-16/h7-10,13,16,20H,5-6,11-12H2,1-4H3/t16-,20-/m1/s1 |
| InChIKey | FJOWXGYLIWJFCH-OXQOHEQNSA-N |
| SMILES | [H][C@@]1(N(C)C[C@H](C(N(CC)CC)=O)C=C12)CC3=CN(C(C)=O)C4=C3C2=CC=C4 |
| Reference | 1: Wagmann L, Richter LHJ, Kehl T, Wack F, Bergstrand MP, Brandt SD, Stratford A, |
