For research use only. Not for therapeutic Use.
Ald-Ph-amido-PEG4-C2-NHS ester(Cat No.:I017750)is a non-cleavable four-unit polyethylene glycol (PEG) linker commonly used in antibody-drug conjugation (ADC) strategies. It acts as a connecting bridge between the antibody and the drug payload in ADC development. The linker is designed to provide stability and control the release of the drug once the ADC reaches the target site. The Ald-Ph-amido-PEG4-C2-NHS ester linker allows for efficient conjugation of the drug to the antibody, facilitating targeted delivery and enhancing therapeutic efficacy.
CAS Number | 1353011-74-1 |
Molecular Formula | C₂₃H₃₀N₂O₁₀ |
Purity | ≥95% |
Target | ADC Linker |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
InChI | InChI=1S/C23H30N2O10/c26-17-18-1-3-19(4-2-18)23(30)24-8-10-32-12-14-34-16-15-33-13-11-31-9-7-22(29)35-25-20(27)5-6-21(25)28/h1-4,17H,5-16H2,(H,24,30) |
InChIKey | QUFDNMPGNAZKHD-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |