For research use only. Not for therapeutic Use.
ALDH1A1-IN-2 is a potent inhibitor of aldehyde dehydrogenase 1a1 (aldh1a1). Aldehyde dehydrogenases (ALDH) constitute a family of enzymes that play a critical role in oxidizing various cytotoxic xenogenic and biogenic aldehydes. ALDH1A1-IN-2 has the potential for the research of cancer, inflammation, or obesity (extracted from patent WO2019089626A1, compound 295)[1].
| Catalog Number | I044114 |
| CAS Number | 2231081-18-6 |
| Synonyms | 1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile |
| Molecular Formula | C25H23ClN4O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C25H23ClN4O3S/c1-34(32,33)30-12-10-29(11-13-30)24(31)21-15-28-22-7-6-19(26)14-20(22)23(21)17-2-4-18(5-3-17)25(16-27)8-9-25/h2-7,14-15H,8-13H2,1H3 |
| InChIKey | MIVWUIQZCQTJER-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C(=O)C2=CN=C3C=CC(=CC3=C2C4=CC=C(C=C4)C5(CC5)C#N)Cl |
| Reference | [1]. Shyh Ming YANG, et al. Substituted quinoline analogs as aldehyde dehydrogenase 1a1 (aldh1a1) inhibitors. Patent WO2019089626A1. |
