For research use only. Not for therapeutic Use.
ALDH1A3-IN-1（Cat No.:I043876）is a selective inhibitor of aldehyde dehydrogenase 1A3 (ALDH1A3), an enzyme involved in the metabolism of aldehydes and the regulation of stem cell function. ALDH1A3 is highly expressed in various cancer stem cells and is associated with drug resistance and tumor progression. By inhibiting ALDH1A3, ALDH1A3-IN-1 has shown potential in reducing cancer stem cell populations, improving treatment responses, and preventing tumor recurrence. This compound is being explored for its ability to target cancer stem cells in malignancies such as glioblastoma, colorectal cancer, and other resistant cancers.
| CAS Number | 1695970-90-1 |
| Synonyms | 3-bromo-4-(dipropylamino)benzaldehyde |
| Molecular Formula | C13H18BrNO |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-4-(dipropylamino)benzaldehyde |
| InChI | InChI=1S/C13H18BrNO/c1-3-7-15(8-4-2)13-6-5-11(10-16)9-12(13)14/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | WIBRZAPMVFXQDF-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C1=C(C=C(C=C1)C=O)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
