For research use only. Not for therapeutic Use.
ALDH1A3-IN-2（Cat No.:I043712）is a selective inhibitor of aldehyde dehydrogenase 1A3 (ALDH1A3), an enzyme implicated in the metabolism of aldehydes and the regulation of cancer stem cells. ALDH1A3 is often overexpressed in cancer stem cells, contributing to tumor progression, metastasis, and resistance to chemotherapy. By inhibiting this enzyme, ALDH1A3-IN-2 has the potential to reduce cancer stem cell populations, sensitize tumors to chemotherapy, and prevent relapse. It is being investigated as a promising therapeutic candidate for the treatment of various cancers, including glioblastoma and other aggressive malignancies.
| CAS Number | 886502-08-5 |
| Synonyms | 3-methyl-4-piperidin-1-ylbenzaldehyde |
| Molecular Formula | C13H17NO |
| Purity | ≥95% |
| IUPAC Name | 3-methyl-4-piperidin-1-ylbenzaldehyde |
| InChI | InChI=1S/C13H17NO/c1-11-9-12(10-15)5-6-13(11)14-7-3-2-4-8-14/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | PFELXGCZCNQNEM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C=O)N2CCCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
