For research use only. Not for therapeutic Use.
Aldometanib(Cat No.:I042709)is an investigational drug being developed for its potential therapeutic applications in treating specific cancer types. It targets key molecular pathways that promote tumor growth and survival, aiming to block the progression of cancer cells. By inhibiting crucial enzymes and receptors involved in cancer cell proliferation, Aldometanib demonstrates promise as a targeted therapy with reduced side effects compared to traditional chemotherapies. Its unique mechanism of action positions it as a potential treatment option for patients with cancers resistant to current treatment regimens, although further clinical studies are required for validation.
CAS Number | 2904601-67-6 |
Synonyms | 1-[(2,6-dichlorophenyl)methyl]-3-hexadecyl-2-methylimidazol-1-ium;iodide |
Molecular Formula | C27H43Cl2IN2 |
Purity | ≥95% |
IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3-hexadecyl-2-methylimidazol-1-ium;iodide |
InChI | InChI=1S/C27H43Cl2N2.HI/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-30-21-22-31(24(30)2)23-25-26(28)18-17-19-27(25)29;/h17-19,21-22H,3-16,20,23H2,1-2H3;1H/q+1;/p-1 |
InChIKey | QGSVKLIYXRLMTB-UHFFFAOYSA-M |
SMILES | CCCCCCCCCCCCCCCCN1C=C[N+](=C1C)CC2=C(C=CC=C2Cl)Cl.[I-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |