For research use only. Not for therapeutic Use.
Aldox is a general term used in chemistry to refer to a functional group consisting of an aldehyde and an oxime. This compound class finds applications in various organic synthesis reactions, including the formation of oximes from aldehydes or ketones. Aldox compounds exhibit diverse chemical reactivity and are important intermediates in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Research focuses on their synthesis, characterization, and utilization in organic transformations for the development of new molecules with desired properties.
CAS Number | 45267-19-4 |
Synonyms | N-[3-(Dimethylamino)propyl]tetradecanamide; Dimethylaminopropyl Myristamide; Lexamine M 13; Myristamidopropyl Dimethylamine; N-[3-(Dimethylamino)propyl]myristamide; Schercodine M; |
Molecular Formula | C19H40N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[3-(dimethylamino)propyl]tetradecanamide |
InChI | InChI=1S/C19H40N2O/c1-4-5-6-7-8-9-10-11-12-13-14-16-19(22)20-17-15-18-21(2)3/h4-18H2,1-3H3,(H,20,22) |
InChIKey | IFYDWYVPVAMGRO-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCC(=O)NCCCN(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |