For research use only. Not for therapeutic Use.
ALE-0540（Cat No.:I012836）is a selective, small-molecule inhibitor of the protein kinase C (PKC) family, specifically targeting the PKCθ isoform. PKCθ plays a key role in regulating immune cell activation, particularly T-cell function. ALE-0540 has been studied for its potential in modulating immune responses and treating autoimmune diseases, as well as for its ability to inhibit the inflammatory pathways involved in conditions like rheumatoid arthritis and multiple sclerosis. Preclinical studies have shown that ALE-0540 can suppress T-cell activation and reduce inflammation. However, further research is needed to evaluate its clinical efficacy, safety, and therapeutic potential.
| Catalog Number | I012836 |
| CAS Number | 234779-34-1 |
| Synonyms | ALE0540; 2-(2-Hydroxy-ethylamino)-5-nitro-benzo[de]isoquinoline-1,3-dione |
| Molecular Formula | C14H11N3O5 |
| Purity | ≥95% |
| IUPAC Name | 2-(2-hydroxyethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| InChI | InChI=1S/C14H11N3O5/c18-5-4-15-16-13(19)10-3-1-2-8-6-9(17(21)22)7-11(12(8)10)14(16)20/h1-3,6-7,15,18H,4-5H2 |
| InChIKey | SURCGQGDUADKBL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C(=C1)C(=O)N(C3=O)NCCO)[N+](=O)[O-] |
