For research use only. Not for therapeutic Use.
Aleplasinin（Cat No.:I001725）is an investigational compound being studied for its potential therapeutic applications in oncology. It is a targeted therapy designed to interact with specific cancer cell pathways, aiming to inhibit tumor growth and metastasis. By modulating key proteins involved in cell proliferation and survival, Aleplasinin may help slow or halt the progression of various cancers. Research is focused on evaluating its efficacy, safety, and potential for treating solid tumors or hematological malignancies. Ongoing studies are exploring its mechanism of action and its suitability as a treatment option for resistant or advanced cancers.
| CAS Number | 481629-87-2 |
| Synonyms | 2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-2-oxoacetic acid |
| Molecular Formula | C28H27NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-[1-[(4-tert-butylphenyl)methyl]-5-(3-methylphenyl)indol-3-yl]-2-oxoacetic acid |
| InChI | InChI=1S/C28H27NO3/c1-18-6-5-7-20(14-18)21-10-13-25-23(15-21)24(26(30)27(31)32)17-29(25)16-19-8-11-22(12-9-19)28(2,3)4/h5-15,17H,16H2,1-4H3,(H,31,32) |
| InChIKey | HSXLMAFNWCSZGP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC3=C(C=C2)N(C=C3C(=O)C(=O)O)CC4=CC=C(C=C4)C(C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
