Alfacalcidol-d6 (Cat No.:S000552)is a specialized alfacalcidol, an active vitamin D used to treat hypocalcemia and metabolic bone diseases like osteoporosis. The “d6” designation indicates that six hydrogen atoms in the alfacalcidol molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of alfacalcidol metabolism and its pharmacokinetics using advanced analytical techniques like mass spectrometry. Alfacalcidol-d6 is a valuable tool in pharmacological studies, elucidating drug metabolism, understanding its cellular effects, and investigating its efficacy and safety profiles in treating hypocalcemia and metabolic bone disorders.
Catalog Number | S000552 |
CAS Number | 1641940-94-4 |
Molecular Formula | C27H38D6O2 |
Purity | ≥95% |
IUPAC Name | (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
InChI | InChI=1S/C27H44O2/c1-18(2)8-6-9-19(3)24-13-14-25-21(10-7-15-27(24,25)5)11-12-22-16-23(28)17-26(29)20(22)4/h11-12,18-19,23-26,28-29H,4,6-10,13-17H2,1-3,5H3/b21-11+,22-12-/t19-,23-,24-,25+,26+,27-/m1/s1/i1D3,2D3 |
InChIKey | OFHCOWSQAMBJIW-VLUFQIGVSA-N |
SMILES | CC(C)CCCC(C)C1CCC2C1(CCCC2=CC=C3CC(CC(C3=C)O)O)C |