For research use only. Not for therapeutic Use.
Alflutinib is an EGFR inhibitor that targets both EGFR activating mutations and T790M, thus leading to tumor growth inhibition.
| Catalog Number | I021759 |
| CAS Number | 1869057-83-9 |
| Synonyms | Alflutinib, AST-2818, AST2818, AST 2818 |
| Molecular Formula | C28H31F3N8O2 |
| Purity | 98% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-Propenamide, N-(2-((2-(dimethylamino)ethyl)methylamino)-5-((4-(1-methyl-1H-indol-3-yl)-2-pyrimidinyl)amino)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl)- |
| InChI | 1S/C28H31F3N8O2/c1-6-24(40)33-21-15-22(26(41-17-28(29,30)31)36-25(21)38(4)14-13-37(2)3)35-27-32-12-11-20(34-27)19-16-39(5)23-10-8-7-9-18(19)23/h6-12,15-16H,1,13-14,17H2,2-5H3,(H,33,40)(H,32,34,35) |
| InChIKey | GHKOONMJXNWOIW-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)c1nc(OCC(F)(F)F)c(Nc2nccc(n2)c3cn(C)c4ccccc34)cc1NC(=O)C=C |
