For research use only. Not for therapeutic Use.
Alicapistat（Cat No.:I001440）is a potent and selective inhibitor of cathepsin S, an enzyme implicated in various inflammatory and autoimmune diseases. By inhibiting cathepsin S, Alicapistat helps reduce the degradation of extracellular matrix proteins, which is crucial in conditions like chronic obstructive pulmonary disease (COPD) and rheumatoid arthritis. This compound is under investigation for its therapeutic potential in modulating immune responses and preventing tissue damage. Alicapistat’s targeted mechanism of action offers promise in treating diseases with an inflammatory component, making it a significant focus in drug development and therapeutic research.
| Catalog Number | I001440 |
| CAS Number | 1254698-46-8 |
| Synonyms | (2R)-1-benzyl-N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| Molecular Formula | C25H27N3O4 |
| Purity | ≥95% |
| IUPAC Name | (2R)-1-benzyl-N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| InChI | InChI=1S/C25H27N3O4/c29-22-14-13-21(28(22)16-18-9-5-2-6-10-18)24(31)27-20(15-17-7-3-1-4-8-17)23(30)25(32)26-19-11-12-19/h1-10,19-21H,11-16H2,(H,26,32)(H,27,31)/t20?,21-/m1/s1 |
| InChIKey | MMLDHJRGTZHNHV-BPGUCPLFSA-N |
| SMILES | C1CC1NC(=O)C(=O)C(CC2=CC=CC=C2)NC(=O)C3CCC(=O)N3CC4=CC=CC=C4 |
