For research use only. Not for therapeutic Use.
Alimemazine-d6(Cat No.:S000466), also known as trimeprazine-d6, is a deuterated form of alimemazine, a phenothiazine derivative used primarily as an antihistamine and antipruritic agent. Deuteration involves replacing hydrogen atoms with deuterium, a heavier isotope, which can impact the metabolic stability and pharmacokinetic properties of the compound. Alimemazine is commonly used to manage allergies and itching and as a pre-operative sedative. The addition of deuterium potentially extends the drug’s duration of action or alters its interaction with metabolic enzymes, making alimemazine-d6 useful in research to better understand the drug’s behavior in the body.
CAS Number | 1346603-88-0 |
Molecular Formula | C18H16D6N2S |
Purity | ≥95% |
IUPAC Name | 2-methyl-3-phenothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine |
InChI | InChI=1S/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3/i2D3,3D3 |
InChIKey | ZZHLYYDVIOPZBE-XERRXZQWSA-N |
SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)CN(C)C |