For research use only. Not for therapeutic Use.
Alinidine hydrobromide is a specific bradycardic agent. Alinidine hydrobromide reduces the slope of the diastolic depolarization in sinoatrial tissue and Purkinje fibers[1].
| Catalog Number | I021770 |
| CAS Number | 71306-36-0 |
| Synonyms | N-(2,6-dichlorophenyl)-N-prop-2-enyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| Molecular Formula | C12H14BrCl2N3 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H13Cl2N3.BrH/c1-2-8-17(12-15-6-7-16-12)11-9(13)4-3-5-10(11)14;/h2-5H,1,6-8H2,(H,15,16);1H |
| InChIKey | JLFOQBZGELKSOT-UHFFFAOYSA-N |
| SMILES | C=CCN(C1=C(C=CC=C1Cl)Cl)C2=NCCN2.Br |
| Reference | [1]. Snyders DJ, et al. Alinidine modifies the pacemaker current in sheep Purkinje fibers. Pflugers Arch. 1987;410(1-2):83-91. |
