For research use only. Not for therapeutic Use.
Alirinetide (GM604) is an oligopeptide containing 6 amino acids. Alirinetide can cross the blood-brain barrier and can be used for the research of multiple neurodegenerative diseases[1].
Alirinetide (GM604) (0.1-10 mg/mL; 24 h) prevents SH-SY5Y cell death[1].
Alirinetide (48 h) predominantly represses Parkinson’s disease-associated genes in SH-SY5Y cells, these genes were largely associated with the mitochondrial protein complex and respiratory chain[1].
Alirinetide (GM604) (0-20 mg/kg; i.v.; twice daily for 5 days) improves behavioral, biochemical, and histological features in the 6-OHDA mouse model[1].
| Catalog Number | I006988 |
| CAS Number | 725715-18-4 |
| Synonyms | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| Molecular Formula | C36H54N12O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C36H54N12O9/c1-20(29(51)46-26(34(56)57)10-6-16-43-36(40)41)44-32(54)27(18-22-11-13-23(50)14-12-22)47-31(53)25(9-5-15-42-35(38)39)45-33(55)28(19-49)48-30(52)24(37)17-21-7-3-2-4-8-21/h2-4,7-8,11-14,20,24-28,49-50H,5-6,9-10,15-19,37H2,1H3,(H,44,54)(H,45,55)(H,46,51)(H,47,53)(H,48,52)(H,56,57)(H4,38,39,42)(H4,40,41,43)/t20-,24-,25-,26-,27-,28-/m0/s1 |
| InChIKey | WVPOPWDCSFQEBI-HJJAOGADSA-N |
| SMILES | CC(C(=O)NC(CCCN=C(N)N)C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CO)NC(=O)C(CC2=CC=CC=C2)N |
| Reference | [1]. Swindell W R, et al. GM604 for Parkinson’s Disease treatment: Pre-clinical findings and results from a pilot placebo-controlled trial. F1000Research, 2017, 6. |
