For research use only. Not for therapeutic Use.
Alisol A(Cat No.:I002525) is a natural product derived from certain plant sources. It possesses beneficial properties such as the ability to lower blood fat and cholesterol levels. By reducing lipid levels, Alisol A may contribute to the prevention and management of cardiovascular diseases. Additionally, it exhibits anti-allergy effects, potentially offering relief from allergic reactions.
CAS Number | 19885-10-0 |
Molecular Formula | C30H50O5 |
Purity | ≥95% |
Target | Autophagy |
Solubility | 10 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | (5R,8S,9S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-17-[(2R,4S,5R)-4,5,6-trihydroxy-6-methylheptan-2-yl]-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C30H50O5/c1-17(15-21(32)25(34)27(4,5)35)18-9-13-29(7)19(18)16-20(31)24-28(6)12-11-23(33)26(2,3)22(28)10-14-30(24,29)8/h17,20-22,24-25,31-32,34-35H,9-16H2,1-8H3/t17-,20+,21+,22+,24+,25-,28+,29+,30+/m1/s1 |
InChIKey | HNOSJVWYGXOFRP-UNPOXIGHSA-N |
SMILES | CC(CC(C(C(C)(C)O)O)O)C1=C2CC(C3C4(CCC(=O)C(C4CCC3(C2(CC1)C)C)(C)C)C)O |