For research use only. Not for therapeutic Use.
Alizarine Yellow R (Mordant orange 1), a salicylic acid derivative, is a azo dye. Alizarine Yellow R is mostly used as a pH indicator, as a biological stain in chemical examinations and also in dyeing industries[1].
| Catalog Number | R071076 |
| CAS Number | 2243-76-7 |
| Synonyms | 2-hydroxy-5-[(4-nitrophenyl)diazenyl]benzoic acid |
| Molecular Formula | C13H9N3O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C13H9N3O5/c17-12-6-3-9(7-11(12)13(18)19)15-14-8-1-4-10(5-2-8)16(20)21/h1-7,17H,(H,18,19) |
| InChIKey | YVJPMMYYRNHJAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=C(C=C2)O)C(=O)O)[N+](=O)[O-] |
| Reference | [1]. Dhanush C, et al. Independent hydrothermal synthesis of the undoped, nitrogen, boron and sulphur doped biogenic carbon nanodots and their potential application in the catalytic chemo-reduction of Alizarine yellow R azo dye. Spectrochim Acta A Mol Biomol Spectrosc. 2021 Nov 5;260:119920. |
