For research use only. Not for therapeutic Use.
ALK Inhibitor 1(CAT: I004817) is a selective and potent inhibitor of anaplastic lymphoma kinase (ALK), a receptor tyrosine kinase involved in regulating cell growth, differentiation, and survival. Abnormal ALK activation, often due to gene rearrangements, mutations, or amplifications, is associated with various cancers, including non-small cell lung cancer (NSCLC), anaplastic large cell lymphoma (ALCL), and neuroblastoma. By inhibiting ALK signaling, ALK Inhibitor 1 effectively blocks downstream pathways like PI3K/AKT, MAPK/ERK, and JAK/STAT, leading to reduced tumor growth and increased apoptosis. This compound is valuable in oncology research for developing targeted therapies against ALK-driven cancers.
| Catalog Number | I004817 |
| CAS Number | 761436-81-1 |
| Synonyms | 2-[[5-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| Molecular Formula | C23H28BrN7O3S |
| Purity | ≥95% |
| Target | Anaplastic lymphoma kinase (ALK) |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 2-[[5-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| InChI | InChI=1S/C23H28BrN7O3S/c1-25-35(32,33)21-7-5-4-6-19(21)27-22-17(24)15-26-23(29-22)28-18-9-8-16(14-20(18)34-3)31-12-10-30(2)11-13-31/h4-9,14-15,25H,10-13H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | FTSDLONCFCQDGA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=CC=C1NC2=NC(=NC=C2Br)NC3=C(C=C(C=C3)N4CCN(CC4)C)OC |
